C16H19NO5 — CID 170883905
methyl 2-amino-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]propanoate (PubChem CID 170883905) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl 2-amino-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]propanoate.
| Compound Name | methyl 2-amino-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170883905 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | methyl 2-amino-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(COc2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C16H19NO5/c1-19-11-3-5-12(6-4-11)21-10-14-8-7-13(22-14)9-15(17)16(18)20-2/h3-8,15H,9-10,17H2,1-2H3 |
| InChIKey | SWLYDUWOTIAXQW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |