C15H15FN2O6 — CID 170883972
methyl 2-amino-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]propanoate (PubChem CID 170883972) has the molecular formula C15H15FN2O6 and a molecular weight of 338.29 g/mol. Its IUPAC name is methyl 2-amino-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]propanoate.
| Compound Name | methyl 2-amino-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170883972 |
| Molecular Formula | C15H15FN2O6 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 2-amino-3-[5-[(5-fluoro-2-nitrophenoxy)methyl]furan-2-yl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(COc2cc(F)ccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H15FN2O6/c1-22-15(19)12(17)7-10-3-4-11(24-10)8-23-14-6-9(16)2-5-13(14)18(20)21/h2-6,12H,7-8,17H2,1H3 |
| InChIKey | YHLKXGBUEJDZBO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|