C18H21NO3 — CID 170884444
methyl 2-amino-3-[4-(cyclopropylmethoxy)naphthalen-1-yl]propanoate (PubChem CID 170884444) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 2-amino-3-[4-(cyclopropylmethoxy)naphthalen-1-yl]propanoate.
| Compound Name | methyl 2-amino-3-[4-(cyclopropylmethoxy)naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 170884444 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl 2-amino-3-[4-(cyclopropylmethoxy)naphthalen-1-yl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(OCC2CC2)c2ccccc12 |
| InChI | InChI=1S/C18H21NO3/c1-21-18(20)16(19)10-13-8-9-17(22-11-12-6-7-12)15-5-3-2-4-14(13)15/h2-5,8-9,12,16H,6-7,10-11,19H2,1H3 |
| InChIKey | BHGUQZXGPKCAEQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |