C17H23N3O3 — CID 170884510
methyl 2-amino-3-[3-[(2-ethylimidazol-1-yl)methyl]-4-methoxyphenyl]propanoate (PubChem CID 170884510) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 2-amino-3-[3-[(2-ethylimidazol-1-yl)methyl]-4-methoxyphenyl]propanoate.
| Compound Name | methyl 2-amino-3-[3-[(2-ethylimidazol-1-yl)methyl]-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 170884510 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 2-amino-3-[3-[(2-ethylimidazol-1-yl)methyl]-4-methoxyphenyl]propanoate |
| SMILES | CCc1nccn1Cc1cc(CC(N)C(=O)OC)ccc1OC |
| InChI | InChI=1S/C17H23N3O3/c1-4-16-19-7-8-20(16)11-13-9-12(5-6-15(13)22-2)10-14(18)17(21)23-3/h5-9,14H,4,10-11,18H2,1-3H3 |
| InChIKey | QIUTVHDFFKLPNS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |