C13H11N3 — CID 170886230
2-[2,3-bis(cyanomethyl)-5-methylphenyl]acetonitrile (PubChem CID 170886230) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[2,3-bis(cyanomethyl)-5-methylphenyl]acetonitrile.
| Compound Name | 2-[2,3-bis(cyanomethyl)-5-methylphenyl]acetonitrile |
|---|---|
| PubChem CID | 170886230 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-[2,3-bis(cyanomethyl)-5-methylphenyl]acetonitrile |
| SMILES | Cc1cc(CC#N)c(CC#N)c(CC#N)c1 |
| InChI | InChI=1S/C13H11N3/c1-10-8-11(2-5-14)13(4-7-16)12(9-10)3-6-15/h8-9H,2-4H2,1H3 |
| InChIKey | ORNNDHFWSWTATJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |