C8H5Cl2NO3 — CID 170887177
3-(3,5-dichloro-4-pyridinyl)-3-oxopropanoic acid (PubChem CID 170887177) has the molecular formula C8H5Cl2NO3 and a molecular weight of 234.04 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-pyridinyl)-3-oxopropanoic acid.
| Compound Name | 3-(3,5-dichloro-4-pyridinyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 170887177 |
| Molecular Formula | C8H5Cl2NO3 |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 3-(3,5-dichloro-4-pyridinyl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C8H5Cl2NO3/c9-4-2-11-3-5(10)8(4)6(12)1-7(13)14/h2-3H,1H2,(H,13,14) |
| InChIKey | GSDSEOKGDATPHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|