C10H4ClF5O3 — CID 170887256
3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)phenyl]-3-oxopropanoic acid (PubChem CID 170887256) has the molecular formula C10H4ClF5O3 and a molecular weight of 302.58 g/mol. Its IUPAC name is 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 170887256 |
| Molecular Formula | C10H4ClF5O3 |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)phenyl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1c(Cl)cc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H4ClF5O3/c11-4-1-3(10(14,15)16)8(12)9(13)7(4)5(17)2-6(18)19/h1H,2H2,(H,18,19) |
| InChIKey | HBBMSDLSVIMONH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|