C6H5Cl3N2O2 — CID 175522535
3,5-dichloro-N-hydroxypyridine-4-carboxamide;hydrochloride (PubChem CID 175522535) has the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.48 g/mol. Its IUPAC name is 3,5-dichloro-N-hydroxypyridine-4-carboxamide;hydrochloride.
| Compound Name | 3,5-dichloro-N-hydroxypyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175522535 |
| Molecular Formula | C6H5Cl3N2O2 |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 3,5-dichloro-N-hydroxypyridine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C6H4Cl2N2O2.ClH/c7-3-1-9-2-4(8)5(3)6(11)10-12;/h1-2,12H,(H,10,11);1H |
| InChIKey | IYJSVYUKWWYOPH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|