C14H11Cl2IN2O2 — CID 20820227
3,5-dichloro-N-[2-hydroxy-1-(4-iodophenyl)ethyl]pyridine-4-carboxamide (PubChem CID 20820227) has the molecular formula C14H11Cl2IN2O2 and a molecular weight of 437.06 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-hydroxy-1-(4-iodophenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[2-hydroxy-1-(4-iodophenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 20820227 |
| Molecular Formula | C14H11Cl2IN2O2 |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 435.92 |
| IUPAC Name | 3,5-dichloro-N-[2-hydroxy-1-(4-iodophenyl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NC(CO)c1ccc(I)cc1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C14H11Cl2IN2O2/c15-10-5-18-6-11(16)13(10)14(21)19-12(7-20)8-1-3-9(17)4-2-8/h1-6,12,20H,7H2,(H,19,21) |
| InChIKey | XAQYOQJTTITXID-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|