C14H22ClNO5 — CID 170891770
ethyl 2-[4-(2-amino-3-hydroxypropyl)-2-methoxyphenoxy]acetate;hydrochloride (PubChem CID 170891770) has the molecular formula C14H22ClNO5 and a molecular weight of 319.79 g/mol. Its IUPAC name is ethyl 2-[4-(2-amino-3-hydroxypropyl)-2-methoxyphenoxy]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-(2-amino-3-hydroxypropyl)-2-methoxyphenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 170891770 |
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl 2-[4-(2-amino-3-hydroxypropyl)-2-methoxyphenoxy]acetate;hydrochloride |
| SMILES | CCOC(=O)COc1ccc(CC(N)CO)cc1OC.Cl |
| InChI | InChI=1S/C14H21NO5.ClH/c1-3-19-14(17)9-20-12-5-4-10(6-11(15)8-16)7-13(12)18-2;/h4-5,7,11,16H,3,6,8-9,15H2,1-2H3;1H |
| InChIKey | QJSNDFZCLDPQMO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |