C19H25NO10 — CID 22951667
3-[3,4-bis(2-ethoxy-2-oxoethoxy)phenyl]-2-(methoxycarbonylamino)propanoic acid (PubChem CID 22951667) has the molecular formula C19H25NO10 and a molecular weight of 427.41 g/mol. Its IUPAC name is 3-[3,4-bis(2-ethoxy-2-oxoethoxy)phenyl]-2-(methoxycarbonylamino)propanoic acid.
| Compound Name | 3-[3,4-bis(2-ethoxy-2-oxoethoxy)phenyl]-2-(methoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 22951667 |
| Molecular Formula | C19H25NO10 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-[3,4-bis(2-ethoxy-2-oxoethoxy)phenyl]-2-(methoxycarbonylamino)propanoic acid |
| SMILES | CCOC(=O)COc1ccc(CC(NC(=O)OC)C(=O)O)cc1OCC(=O)OCC |
| InChI | InChI=1S/C19H25NO10/c1-4-27-16(21)10-29-14-7-6-12(8-13(18(23)24)20-19(25)26-3)9-15(14)30-11-17(22)28-5-2/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,20,25)(H,23,24) |
| InChIKey | VFGYPCSTDGRMKL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|