C11H14Cl2N2 — CID 170893856
1-(3-chloro-1H-indol-2-yl)propan-2-amine;hydrochloride (PubChem CID 170893856) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-(3-chloro-1H-indol-2-yl)propan-2-amine;hydrochloride.
| Compound Name | 1-(3-chloro-1H-indol-2-yl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170893856 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(3-chloro-1H-indol-2-yl)propan-2-amine;hydrochloride |
| SMILES | CC(N)Cc1[nH]c2ccccc2c1Cl.Cl |
| InChI | InChI=1S/C11H13ClN2.ClH/c1-7(13)6-10-11(12)8-4-2-3-5-9(8)14-10;/h2-5,7,14H,6,13H2,1H3;1H |
| InChIKey | DAOBWUBLNWPEJT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |