C12H14ClN3 — CID 170894877
1-[1-(2-chlorophenyl)pyrrol-2-yl]ethane-1,2-diamine (PubChem CID 170894877) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)pyrrol-2-yl]ethane-1,2-diamine.
| Compound Name | 1-[1-(2-chlorophenyl)pyrrol-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894877 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-[1-(2-chlorophenyl)pyrrol-2-yl]ethane-1,2-diamine |
| SMILES | NCC(N)c1cccn1-c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClN3/c13-9-4-1-2-5-11(9)16-7-3-6-12(16)10(15)8-14/h1-7,10H,8,14-15H2 |
| InChIKey | CXKYRPVEXDXTCU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |