C21H26N4O — CID 170894894
2-[3-(1,2-diaminoethyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanol (PubChem CID 170894894) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[3-(1,2-diaminoethyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanol.
| Compound Name | 2-[3-(1,2-diaminoethyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanol |
|---|---|
| PubChem CID | 170894894 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[3-(1,2-diaminoethyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanol |
| SMILES | Cc1c(C(N)CN)c2ccccc2n1CC(O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H26N4O/c1-14-21(17(23)12-22)16-7-3-5-9-19(16)25(14)13-20(26)24-11-10-15-6-2-4-8-18(15)24/h2-9,17,20,26H,10-13,22-23H2,1H3 |
| InChIKey | QIFLQPFYODDLRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|