C16H16Cl2N2O2S — CID 170895609
2-chloro-N-[5-(4-chlorophenyl)-2-[2-(dimethylamino)acetyl]thiophen-3-yl]acetamide (PubChem CID 170895609) has the molecular formula C16H16Cl2N2O2S and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-chloro-N-[5-(4-chlorophenyl)-2-[2-(dimethylamino)acetyl]thiophen-3-yl]acetamide.
| Compound Name | 2-chloro-N-[5-(4-chlorophenyl)-2-[2-(dimethylamino)acetyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 170895609 |
| Molecular Formula | C16H16Cl2N2O2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-chloro-N-[5-(4-chlorophenyl)-2-[2-(dimethylamino)acetyl]thiophen-3-yl]acetamide |
| SMILES | CN(C)CC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)CCl |
| InChI | InChI=1S/C16H16Cl2N2O2S/c1-20(2)9-13(21)16-12(19-15(22)8-17)7-14(23-16)10-3-5-11(18)6-4-10/h3-7H,8-9H2,1-2H3,(H,19,22) |
| InChIKey | FZSSGUYFZCYDPH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|