C20H15Cl2NO2S2 — CID 2807903
N-[2-acetyl-5-(4-chlorophenyl)thiophen-3-yl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 2807903) has the molecular formula C20H15Cl2NO2S2 and a molecular weight of 436.39 g/mol. Its IUPAC name is N-[2-acetyl-5-(4-chlorophenyl)thiophen-3-yl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[2-acetyl-5-(4-chlorophenyl)thiophen-3-yl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 2807903 |
| Molecular Formula | C20H15Cl2NO2S2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | N-[2-acetyl-5-(4-chlorophenyl)thiophen-3-yl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | CC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2NO2S2/c1-12(24)20-17(10-18(27-20)13-2-4-14(21)5-3-13)23-19(25)11-26-16-8-6-15(22)7-9-16/h2-10H,11H2,1H3,(H,23,25) |
| InChIKey | PVJGKKTXDBGJNJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |