C18H21FN2O3 — CID 170895761
3-[3-[2-(dimethylamino)acetyl]-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]propanoic acid (PubChem CID 170895761) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[3-[2-(dimethylamino)acetyl]-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]propanoic acid.
| Compound Name | 3-[3-[2-(dimethylamino)acetyl]-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 170895761 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[3-[2-(dimethylamino)acetyl]-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]propanoic acid |
| SMILES | Cc1c(C(=O)CN(C)C)cc(-c2ccc(F)cc2)n1CCC(=O)O |
| InChI | InChI=1S/C18H21FN2O3/c1-12-15(17(22)11-20(2)3)10-16(21(12)9-8-18(23)24)13-4-6-14(19)7-5-13/h4-7,10H,8-9,11H2,1-3H3,(H,23,24) |
| InChIKey | MYJCIILGQWLHOU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |