C15H16FNO2 — CID 82363976
4-[2-(4-fluorophenyl)-4-methylpyrrol-1-yl]butanoic acid (PubChem CID 82363976) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-4-methylpyrrol-1-yl]butanoic acid.
| Compound Name | 4-[2-(4-fluorophenyl)-4-methylpyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82363976 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-4-methylpyrrol-1-yl]butanoic acid |
| SMILES | Cc1cc(-c2ccc(F)cc2)n(CCCC(=O)O)c1 |
| InChI | InChI=1S/C15H16FNO2/c1-11-9-14(12-4-6-13(16)7-5-12)17(10-11)8-2-3-15(18)19/h4-7,9-10H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | LTQBONZYWVUWBQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |