C20H26FNO4 — CID 141004681
7-[2-(4-fluorophenyl)-3,4-dihydroxy-5-propan-2-ylpyrrol-1-yl]heptanoic acid (PubChem CID 141004681) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)-3,4-dihydroxy-5-propan-2-ylpyrrol-1-yl]heptanoic acid.
| Compound Name | 7-[2-(4-fluorophenyl)-3,4-dihydroxy-5-propan-2-ylpyrrol-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 141004681 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 7-[2-(4-fluorophenyl)-3,4-dihydroxy-5-propan-2-ylpyrrol-1-yl]heptanoic acid |
| SMILES | CC(C)c1c(O)c(O)c(-c2ccc(F)cc2)n1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H26FNO4/c1-13(2)17-19(25)20(26)18(14-8-10-15(21)11-9-14)22(17)12-6-4-3-5-7-16(23)24/h8-11,13,25-26H,3-7,12H2,1-2H3,(H,23,24) |
| InChIKey | DJUWAACXZFNTOZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|