C19H23FN2O2 — CID 4994805
2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-N-tert-butylacetamide (PubChem CID 4994805) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 4994805 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-N-tert-butylacetamide |
| SMILES | CC(=O)c1cc(-c2ccc(F)cc2)n(CC(=O)NC(C)(C)C)c1C |
| InChI | InChI=1S/C19H23FN2O2/c1-12-16(13(2)23)10-17(14-6-8-15(20)9-7-14)22(12)11-18(24)21-19(3,4)5/h6-10H,11H2,1-5H3,(H,21,24) |
| InChIKey | DNGJZWFUPGHPNY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |