C26H28FN3O2 — CID 20969490
2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-1-(4-benzylpiperazin-1-yl)ethanone (PubChem CID 20969490) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-1-(4-benzylpiperazin-1-yl)ethanone.
| Compound Name | 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-1-(4-benzylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 20969490 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[3-acetyl-5-(4-fluorophenyl)-2-methylpyrrol-1-yl]-1-(4-benzylpiperazin-1-yl)ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(F)cc2)n(CC(=O)N2CCN(Cc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C26H28FN3O2/c1-19-24(20(2)31)16-25(22-8-10-23(27)11-9-22)30(19)18-26(32)29-14-12-28(13-15-29)17-21-6-4-3-5-7-21/h3-11,16H,12-15,17-18H2,1-2H3 |
| InChIKey | RCVAKWAJNFJFCP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |