C10H13N3O2S — CID 170896524
methyl N'-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)carbamimidothioate (PubChem CID 170896524) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl N'-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)carbamimidothioate.
| Compound Name | methyl N'-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)carbamimidothioate |
|---|---|
| PubChem CID | 170896524 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl N'-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)carbamimidothioate |
| SMILES | CS/C(N)=N/N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C10H13N3O2S/c1-16-10(11)12-13-8(14)6-4-2-3-5-7(6)9(13)15/h2-3,6-7H,4-5H2,1H3,(H2,11,12) |
| InChIKey | FOOCMVDAEQMXRW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|