C23H27NO4 — CID 170896980
(3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-4,4-dimethyl-3-(methylamino)pentanoic acid (PubChem CID 170896980) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-4,4-dimethyl-3-(methylamino)pentanoic acid.
| Compound Name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-4,4-dimethyl-3-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 170896980 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-4,4-dimethyl-3-(methylamino)pentanoic acid |
| SMILES | CN[C@@H](C(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C23H27NO4/c1-23(2,3)20(24-4)19(21(25)26)22(27)28-13-18-16-11-7-5-9-14(16)15-10-6-8-12-17(15)18/h5-12,18-20,24H,13H2,1-4H3,(H,25,26)/t19?,20-/m0/s1 |
| InChIKey | OQBFLYFVDNHVSW-ANYOKISRSA-N |
| XLogP | 3.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|