C24H27ClN2 — CID 170898686
N-[(E)-[2-chloro-4,4,6,6-tetramethyl-3-(phenyliminomethyl)cyclohex-2-en-1-ylidene]methyl]aniline (PubChem CID 170898686) has the molecular formula C24H27ClN2 and a molecular weight of 378.95 g/mol. Its IUPAC name is N-[(E)-[2-chloro-4,4,6,6-tetramethyl-3-(phenyliminomethyl)cyclohex-2-en-1-ylidene]methyl]aniline.
| Compound Name | N-[(E)-[2-chloro-4,4,6,6-tetramethyl-3-(phenyliminomethyl)cyclohex-2-en-1-ylidene]methyl]aniline |
|---|---|
| PubChem CID | 170898686 |
| Molecular Formula | C24H27ClN2 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[(E)-[2-chloro-4,4,6,6-tetramethyl-3-(phenyliminomethyl)cyclohex-2-en-1-ylidene]methyl]aniline |
| SMILES | CC1(C)CC(C)(C)/C(=C\Nc2ccccc2)C(Cl)=C1/C=N/c1ccccc1 |
| InChI | InChI=1S/C24H27ClN2/c1-23(2)17-24(3,4)21(16-27-19-13-9-6-10-14-19)22(25)20(23)15-26-18-11-7-5-8-12-18/h5-16,26H,17H2,1-4H3/b20-15-,27-16+ |
| InChIKey | YTONJHSSKOFTEM-ODYQEZDNSA-N |
| XLogP | 7.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|