C13H18F4N2OS — CID 170902519
N-[(1S)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 170902519) has the molecular formula C13H18F4N2OS and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[(1S)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 170902519 |
| Molecular Formula | C13H18F4N2OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[(1S)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](NS(=O)C(C)(C)C)c1cc(N)cc(C(F)(F)F)c1F |
| InChI | InChI=1S/C13H18F4N2OS/c1-7(19-21(20)12(2,3)4)9-5-8(18)6-10(11(9)14)13(15,16)17/h5-7,19H,18H2,1-4H3/t7-,21?/m0/s1 |
| InChIKey | ACGXTSIQRHKMCN-KUSNVBIKSA-N |
| XLogP | 3.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|