C18H28N2O2 — CID 170903137
tert-butyl 7-amino-5-ethyl-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate (PubChem CID 170903137) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl 7-amino-5-ethyl-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-amino-5-ethyl-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 170903137 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl 7-amino-5-ethyl-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
| SMILES | CCc1cc(N)cc2c1C(C)(C)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C18H28N2O2/c1-7-12-8-14(19)9-13-10-20(11-18(5,6)15(12)13)16(21)22-17(2,3)4/h8-9H,7,10-11,19H2,1-6H3 |
| InChIKey | XBQADIDEAZKDNE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|