C24H6F6N6 — CID 170905419
20,23,25,26,27,28-hexafluoro-3,5,6,7,8,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2,4(9),5,7,10,12,14,16,18,20,23,25,27,29-pentadecaene (PubChem CID 170905419) has the molecular formula C24H6F6N6 and a molecular weight of 492.34 g/mol. Its IUPAC name is 20,23,25,26,27,28-hexafluoro-3,5,6,7,8,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2,4(9),5,7,10,12,14,16,18,20,23,25,27,29-pentadecaene.
| Compound Name | 20,23,25,26,27,28-hexafluoro-3,5,6,7,8,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2,4(9),5,7,10,12,14,16,18,20,23,25,27,29-pentadecaene |
|---|---|
| PubChem CID | 170905419 |
| Molecular Formula | C24H6F6N6 |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 20,23,25,26,27,28-hexafluoro-3,5,6,7,8,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2,4(9),5,7,10,12,14,16,18,20,23,25,27,29-pentadecaene |
| SMILES | Fc1c(F)c(F)c2c(F)c3c(nc2c1F)c1nc2nnnnc2cc1c1cc2ccccc2c(F)c13 |
| InChI | InChI=1S/C24H6F6N6/c25-15-8-4-2-1-3-7(8)5-9-10-6-11-24(34-36-35-33-11)32-21(10)23-13(12(9)15)16(26)14-17(27)18(28)19(29)20(30)22(14)31-23/h1-6H |
| InChIKey | IQBDATRTLIZUOI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|