C42H22F4N8 — CID 139229465
2,9-bis[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline (PubChem CID 139229465) has the molecular formula C42H22F4N8 and a molecular weight of 714.69 g/mol. Its IUPAC name is 2,9-bis[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 139229465 |
| Molecular Formula | C42H22F4N8 |
| Molecular Weight | 714.69 g/mol |
| Exact Mass | 714.19 |
| IUPAC Name | 2,9-bis[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline |
| SMILES | Fc1ccc(-c2nnc(-c3ccc4ccc5ccc(-c6nnc(-c7ccc(F)cc7)c(-c7ccc(F)cc7)n6)nc5c4n3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C42H22F4N8/c43-29-13-3-25(4-14-29)37-39(27-7-17-31(45)18-8-27)51-53-41(49-37)33-21-11-23-1-2-24-12-22-34(48-36(24)35(23)47-33)42-50-38(26-5-15-30(44)16-6-26)40(52-54-42)28-9-19-32(46)20-10-28/h1-22H |
| InChIKey | UKGAIZWLLGVLPG-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|