C7H9F3N2OS — CID 170906568
2-(trifluoromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 170906568) has the molecular formula C7H9F3N2OS and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-(trifluoromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(trifluoromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 170906568 |
| Molecular Formula | C7H9F3N2OS |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-(trifluoromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(C(F)(F)F)NC2CCSC12 |
| InChI | InChI=1S/C7H9F3N2OS/c8-7(9,10)6-11-3-1-2-14-4(3)5(13)12-6/h3-4,6,11H,1-2H2,(H,12,13) |
| InChIKey | UUIZUCLGUZAJIL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |