C7H11ClN2OS — CID 130136308
2-(chloromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 130136308) has the molecular formula C7H11ClN2OS and a molecular weight of 206.70 g/mol. Its IUPAC name is 2-(chloromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(chloromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 130136308 |
| Molecular Formula | C7H11ClN2OS |
| Molecular Weight | 206.70 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-(chloromethyl)-2,3,4a,6,7,7a-hexahydro-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(CCl)NC2CCSC12 |
| InChI | InChI=1S/C7H11ClN2OS/c8-3-5-9-4-1-2-12-6(4)7(11)10-5/h4-6,9H,1-3H2,(H,10,11) |
| InChIKey | RZGMTUNHZLAYPM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.70 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|