C9H12OS2 — CID 171055588
3,11-dithiatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 171055588) has the molecular formula C9H12OS2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 3,11-dithiatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | 3,11-dithiatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 171055588 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3,11-dithiatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | O=C1C2CCSC2C2SCCC12 |
| InChI | InChI=1S/C9H12OS2/c10-7-5-1-3-11-8(5)9-6(7)2-4-12-9/h5-6,8-9H,1-4H2 |
| InChIKey | VBGSFGABUBELPV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |