C18H16N2O2S4 — CID 171055578
2-[4-(4,6-dioxo-1,3,3a,6a-tetrahydrothieno[3,4-c]thiophen-3-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile (PubChem CID 171055578) has the molecular formula C18H16N2O2S4 and a molecular weight of 420.61 g/mol. Its IUPAC name is 2-[4-(4,6-dioxo-1,3,3a,6a-tetrahydrothieno[3,4-c]thiophen-3-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile.
| Compound Name | 2-[4-(4,6-dioxo-1,3,3a,6a-tetrahydrothieno[3,4-c]thiophen-3-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171055578 |
| Molecular Formula | C18H16N2O2S4 |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 2-[4-(4,6-dioxo-1,3,3a,6a-tetrahydrothieno[3,4-c]thiophen-3-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2CCSC2C2SC(C3SCC4C(=O)SC(=O)C43)CC12 |
| InChI | InChI=1S/C18H16N2O2S4/c19-4-7(5-20)12-8-1-2-23-14(8)15-9(12)3-11(25-15)16-13-10(6-24-16)17(21)26-18(13)22/h8-11,13-16H,1-3,6H2 |
| InChIKey | XSGUUJRSGJEPNS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|