C27H24N2O2 — CID 177390447
2-[(1S,2S,13R,14R,15S,16S,19R,20R)-4,11-dimethoxy-22-heptacyclo[12.6.1.116,19.02,13.03,12.05,10.015,20]docosa-3,5,7,9,11-pentaenylidene]propanedinitrile (PubChem CID 177390447) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(1S,2S,13R,14R,15S,16S,19R,20R)-4,11-dimethoxy-22-heptacyclo[12.6.1.116,19.02,13.03,12.05,10.015,20]docosa-3,5,7,9,11-pentaenylidene]propanedinitrile.
| Compound Name | 2-[(1S,2S,13R,14R,15S,16S,19R,20R)-4,11-dimethoxy-22-heptacyclo[12.6.1.116,19.02,13.03,12.05,10.015,20]docosa-3,5,7,9,11-pentaenylidene]propanedinitrile |
|---|---|
| PubChem CID | 177390447 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[(1S,2S,13R,14R,15S,16S,19R,20R)-4,11-dimethoxy-22-heptacyclo[12.6.1.116,19.02,13.03,12.05,10.015,20]docosa-3,5,7,9,11-pentaenylidene]propanedinitrile |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@H]1[C@H]3C[C@@H]([C@@H]21)[C@H]1[C@@H]3[C@H]2CC[C@@H]1C2=C(C#N)C#N |
| InChI | InChI=1S/C27H24N2O2/c1-30-26-13-5-3-4-6-14(13)27(31-2)25-23-18-9-17(22(23)24(25)26)20-15-7-8-16(21(18)20)19(15)12(10-28)11-29/h3-6,15-18,20-23H,7-9H2,1-2H3/t15-,16+,17-,18+,20+,21-,22-,23+ |
| InChIKey | NEJFLCRHGDCIQP-ZKJWYQRWSA-N |
| XLogP | 5.30 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'} |
|---|