C16H12Br4N2O2 — CID 10099820
2-(5,6,8,9-tetrabromo-1,4-dimethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)propanedinitrile (PubChem CID 10099820) has the molecular formula C16H12Br4N2O2 and a molecular weight of 583.90 g/mol. Its IUPAC name is 2-(5,6,8,9-tetrabromo-1,4-dimethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)propanedinitrile.
| Compound Name | 2-(5,6,8,9-tetrabromo-1,4-dimethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 10099820 |
| Molecular Formula | C16H12Br4N2O2 |
| Molecular Weight | 583.90 g/mol |
| Exact Mass | 579.76 |
| IUPAC Name | 2-(5,6,8,9-tetrabromo-1,4-dimethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)propanedinitrile |
| SMILES | COc1ccc(OC)c2c1C(Br)C(Br)C(=C(C#N)C#N)C(Br)C2Br |
| InChI | InChI=1S/C16H12Br4N2O2/c1-23-8-3-4-9(24-2)12-11(8)15(19)13(17)10(7(5-21)6-22)14(18)16(12)20/h3-4,13-16H,1-2H3 |
| InChIKey | HWZCMNZXINWQGF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|