C20H25FN4S2 — CID 171055576
2-[5-(2-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,6-naphthyridin-7-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile (PubChem CID 171055576) has the molecular formula C20H25FN4S2 and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[5-(2-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,6-naphthyridin-7-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile.
| Compound Name | 2-[5-(2-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,6-naphthyridin-7-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171055576 |
| Molecular Formula | C20H25FN4S2 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[5-(2-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,6-naphthyridin-7-yl)-3,11-dithiatricyclo[6.3.0.02,6]undecan-7-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2CCSC2C2SCC(C3CC4NC(F)CCC4CN3)C12 |
| InChI | InChI=1S/C20H25FN4S2/c21-16-2-1-10-8-24-15(5-14(10)25-16)13-9-27-20-18(13)17(11(6-22)7-23)12-3-4-26-19(12)20/h10,12-16,18-20,24-25H,1-5,8-9H2 |
| InChIKey | RDYMULLRMHNDRH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|