C18H8N4OS2 — CID 45100741
2-[(1S,11R)-9-(dicyanomethylidene)-6-oxo-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-dien-3-ylidene]propanedinitrile (PubChem CID 45100741) has the molecular formula C18H8N4OS2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[(1S,11R)-9-(dicyanomethylidene)-6-oxo-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-dien-3-ylidene]propanedinitrile.
| Compound Name | 2-[(1S,11R)-9-(dicyanomethylidene)-6-oxo-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-dien-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 45100741 |
| Molecular Formula | C18H8N4OS2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-[(1S,11R)-9-(dicyanomethylidene)-6-oxo-5,7-dithiatetracyclo[9.2.1.02,10.04,8]tetradeca-4(8),12-dien-3-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2sc(=O)sc2C(=C(C#N)C#N)C2C1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C18H8N4OS2/c19-4-10(5-20)14-12-8-1-2-9(3-8)13(12)15(11(6-21)7-22)17-16(14)24-18(23)25-17/h1-2,8-9,12-13H,3H2/t8-,9+,12?,13? |
| InChIKey | PRDHWPWEGXLBAW-RFZWMSCOSA-N |
| XLogP | 3.22 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|