C18H14N2O2 — CID 98478500
(1R,2R,4R,5S,8S,9R,11S,12R)-3,10-dioxopentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-diene-2,11-dicarbonitrile (PubChem CID 98478500) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is (1R,2R,4R,5S,8S,9R,11S,12R)-3,10-dioxopentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-diene-2,11-dicarbonitrile.
| Compound Name | (1R,2R,4R,5S,8S,9R,11S,12R)-3,10-dioxopentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-diene-2,11-dicarbonitrile |
|---|---|
| PubChem CID | 98478500 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (1R,2R,4R,5S,8S,9R,11S,12R)-3,10-dioxopentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-diene-2,11-dicarbonitrile |
| SMILES | N#C[C@@]12C(=O)[C@H]3[C@H](C(=O)[C@]1(C#N)[C@H]1C=C[C@H]2C1)[C@@H]1C=C[C@@H]3C1 |
| InChI | InChI=1S/C18H14N2O2/c19-7-17-11-3-4-12(6-11)18(17,8-20)16(22)14-10-2-1-9(5-10)13(14)15(17)21/h1-4,9-14H,5-6H2/t9-,10-,11+,12+,13-,14-,17-,18+/m1/s1 |
| InChIKey | RUAFZEMUROLTPA-ZOCCQFJOSA-N |
| XLogP | 1.80 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|