C17H20N2O — CID 173466433
2-(4,7-dimethyl-2-oxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-1-ylidene)propanedinitrile (PubChem CID 173466433) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(4,7-dimethyl-2-oxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-1-ylidene)propanedinitrile.
| Compound Name | 2-(4,7-dimethyl-2-oxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 173466433 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(4,7-dimethyl-2-oxo-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylen-1-ylidene)propanedinitrile |
| SMILES | CC1CC2CC(C)CC3C(=C(C#N)C#N)C(=O)C(C1)C23 |
| InChI | InChI=1S/C17H20N2O/c1-9-3-11-4-10(2)6-14-15(11)13(5-9)16(17(14)20)12(7-18)8-19/h9-11,13-15H,3-6H2,1-2H3 |
| InChIKey | FIPPNZQIRPAJDE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|