About 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide
3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide (PubChem CID 143732119) has the molecular formula C8H17BrO
and a molecular weight of 209.13 g/mol. Its IUPAC name is 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide.
Molecular Properties
| Compound Name | 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide |
| PubChem CID | 143732119 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide |
| SMILES | Br.CC1CC2CC(=O)C2C1.[H][H].[H][H] |
| InChI | InChI=1S/C8H12O.BrH.2H2/c1-5-2-6-4-8(9)7(6)3-5;;;/h5-7H,2-4H2,1H3;3*1H |
| InChIKey | NUJISKFNVOXUKU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide?
The IUPAC name of 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide (CID 143732119) is 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide.
What is the SMILES notation for 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide?
The canonical SMILES for 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide is Br.CC1CC2CC(=O)C2C1.[H][H].[H][H].
What is the InChIKey of 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide?
The InChIKey is NUJISKFNVOXUKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.BrH.2H2/c1-5-2-6-4-8(9)7(6)3-5;;;/h5-7H,2-4H2,1H3;3*1H.
What are the key properties of 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide?
3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide has a molecular weight of 209.13 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbicyclo[3.2.0]heptan-6-one;molecular hydrogen;hydrobromide is sourced from PubChem (CID 143732119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).