C16H24O2 — CID 123266550
3-ethyl-4,7-dimethyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-dione (PubChem CID 123266550) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-ethyl-4,7-dimethyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-dione.
| Compound Name | 3-ethyl-4,7-dimethyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-dione |
|---|---|
| PubChem CID | 123266550 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-ethyl-4,7-dimethyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-dione |
| SMILES | CCC1C(C)CC2CC(C)CC3C(=O)C(=O)C1C23 |
| InChI | InChI=1S/C16H24O2/c1-4-11-9(3)7-10-5-8(2)6-12-13(10)14(11)16(18)15(12)17/h8-14H,4-7H2,1-3H3 |
| InChIKey | CSIHIIOJCNZIAS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|