C14H26O — CID 59100166
(1S,7S,8S,8aS)-8-ethyl-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (PubChem CID 59100166) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (1S,7S,8S,8aS)-8-ethyl-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol.
| Compound Name | (1S,7S,8S,8aS)-8-ethyl-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 59100166 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (1S,7S,8S,8aS)-8-ethyl-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| SMILES | CC[C@@H]1[C@@H]2C(CC[C@@H]1C)CC(C)C[C@@H]2O |
| InChI | InChI=1S/C14H26O/c1-4-12-10(3)5-6-11-7-9(2)8-13(15)14(11)12/h9-15H,4-8H2,1-3H3/t9?,10-,11?,12-,13-,14-/m0/s1 |
| InChIKey | NWTXNTSTVPCOLY-LNQOSFKHSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |