C15H28O — CID 59055193
trans-(2R,5R)-5-(4-ethylcyclohexyl)-2-methylcyclohexan-1-ol (PubChem CID 59055193) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is trans-(2R,5R)-5-(4-ethylcyclohexyl)-2-methylcyclohexan-1-ol.
| Compound Name | trans-(2R,5R)-5-(4-ethylcyclohexyl)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 59055193 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | trans-(2R,5R)-5-(4-ethylcyclohexyl)-2-methylcyclohexan-1-ol |
| SMILES | CCC1CCC([C@@H]2CC[C@@H](C)C(O)C2)CC1 |
| InChI | InChI=1S/C15H28O/c1-3-12-5-8-13(9-6-12)14-7-4-11(2)15(16)10-14/h11-16H,3-10H2,1-2H3/t11-,12?,13?,14-,15?/m1/s1 |
| InChIKey | QFQBXCWZZWFMAI-PMNGPLLRSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |