C13H24 — CID 123875044
1,2,5,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 123875044) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,2,5,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1,2,5,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 123875044 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,2,5,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC(C)C2C(C1)CC(C)C2C |
| InChI | InChI=1S/C13H24/c1-8-5-10(3)13-11(4)9(2)7-12(13)6-8/h8-13H,5-7H2,1-4H3 |
| InChIKey | VYBICSOBPJVEED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |