C15H22BNO3 — CID 170906636
(6-phenylmethoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)boronic acid (PubChem CID 170906636) has the molecular formula C15H22BNO3 and a molecular weight of 275.16 g/mol. Its IUPAC name is (6-phenylmethoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)boronic acid.
| Compound Name | (6-phenylmethoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)boronic acid |
|---|---|
| PubChem CID | 170906636 |
| Molecular Formula | C15H22BNO3 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (6-phenylmethoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)boronic acid |
| SMILES | OB(O)C1CC2CCC(OCc3ccccc3)CC2N1 |
| InChI | InChI=1S/C15H22BNO3/c18-16(19)15-8-12-6-7-13(9-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-5,12-15,17-19H,6-10H2 |
| InChIKey | VGSNRZOTLXPJST-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|