C24H25NO4 — CID 170908599
(1,3-dioxo-2-phenylinden-2-yl)methyl 3-piperidin-1-ylpropanoate (PubChem CID 170908599) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (1,3-dioxo-2-phenylinden-2-yl)methyl 3-piperidin-1-ylpropanoate.
| Compound Name | (1,3-dioxo-2-phenylinden-2-yl)methyl 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 170908599 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (1,3-dioxo-2-phenylinden-2-yl)methyl 3-piperidin-1-ylpropanoate |
| SMILES | O=C(CCN1CCCCC1)OCC1(c2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H25NO4/c26-21(13-16-25-14-7-2-8-15-25)29-17-24(18-9-3-1-4-10-18)22(27)19-11-5-6-12-20(19)23(24)28/h1,3-6,9-12H,2,7-8,13-17H2 |
| InChIKey | PTEJUUUJYNLHOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|