C19H29N3S — CID 170909194
3-decyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 170909194) has the molecular formula C19H29N3S and a molecular weight of 331.53 g/mol. Its IUPAC name is 3-decyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | 3-decyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 170909194 |
| Molecular Formula | C19H29N3S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-decyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | [H]/N=C1\SCC(c2ccccc2)=NN1CCCCCCCCCC |
| InChI | InChI=1S/C19H29N3S/c1-2-3-4-5-6-7-8-12-15-22-19(20)23-16-18(21-22)17-13-10-9-11-14-17/h9-11,13-14,20H,2-8,12,15-16H2,1H3/b20-19- |
| InChIKey | JKONDYYVVTXTOB-VXPUYCOJSA-N |
| XLogP | 5.51 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|