C13H18IN3S — CID 170909187
3-butyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine;hydroiodide (PubChem CID 170909187) has the molecular formula C13H18IN3S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3-butyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine;hydroiodide.
| Compound Name | 3-butyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine;hydroiodide |
|---|---|
| PubChem CID | 170909187 |
| Molecular Formula | C13H18IN3S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 3-butyl-5-phenyl-6H-1,3,4-thiadiazin-2-imine;hydroiodide |
| SMILES | I.[H]/N=C1\SCC(c2ccccc2)=NN1CCCC |
| InChI | InChI=1S/C13H17N3S.HI/c1-2-3-9-16-13(14)17-10-12(15-16)11-7-5-4-6-8-11;/h4-8,14H,2-3,9-10H2,1H3;1H/b14-13-; |
| InChIKey | KXUUYKQBHCADKT-HPWRNOGASA-N |
| XLogP | 3.79 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|