C15H14N2O — CID 170911357
1-nitroso-7-phenyl-3,4-dihydro-2H-quinoline (PubChem CID 170911357) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-nitroso-7-phenyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-nitroso-7-phenyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 170911357 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-nitroso-7-phenyl-3,4-dihydro-2H-quinoline |
| SMILES | O=NN1CCCc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C15H14N2O/c18-16-17-10-4-7-13-8-9-14(11-15(13)17)12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2 |
| InChIKey | GCXALHGZFPQERK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|