C24H24N4O5S2 — CID 170917160
(Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170917160) has the molecular formula C24H24N4O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917160 |
| Molecular Formula | C24H24N4O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCc1cc(C)cc(OCCOc2ccc(/C=C(/C#N)C(=O)Nc3nc(S(C)(=O)=O)ns3)cc2)c1 |
| InChI | InChI=1S/C24H24N4O5S2/c1-4-17-11-16(2)12-21(14-17)33-10-9-32-20-7-5-18(6-8-20)13-19(15-25)22(29)26-23-27-24(28-34-23)35(3,30)31/h5-8,11-14H,4,9-10H2,1-3H3,(H,26,27,28,29)/b19-13- |
| InChIKey | RTQQMYGJGJWRSC-UYRXBGFRSA-N |
| XLogP | 3.82 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|