About 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride
1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride (PubChem CID 170918429) has the molecular formula C10H15Cl2N3
and a molecular weight of 248.16 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride |
| PubChem CID | 170918429 |
| Molecular Formula | C10H15Cl2N3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1(c2ncc3c(n2)CCC3)CC1 |
| InChI | InChI=1S/C10H13N3.2ClH/c11-10(4-5-10)9-12-6-7-2-1-3-8(7)13-9;;/h6H,1-5,11H2;2*1H |
| InChIKey | RHISBHCXHHZNGW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride?
The IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride (CID 170918429) is 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride.
What is the SMILES notation for 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride?
The canonical SMILES for 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride is Cl.Cl.NC1(c2ncc3c(n2)CCC3)CC1.
What is the InChIKey of 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride?
The InChIKey is RHISBHCXHHZNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.2ClH/c11-10(4-5-10)9-12-6-7-2-1-3-8(7)13-9;;/h6H,1-5,11H2;2*1H.
What are the key properties of 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride?
1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride has a molecular weight of 248.16 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)cyclopropan-1-amine;dihydrochloride is sourced from PubChem (CID 170918429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).